CymitQuimica logo

CAS 92288-70-5

:

Benzeneacetic acid, 4-(2-oxo-3-oxazolidinyl)-

Description:
Benzeneacetic acid, 4-(2-oxo-3-oxazolidinyl)-, also known by its CAS number 92288-70-5, is a chemical compound characterized by its unique structure that combines a benzeneacetic acid moiety with a 2-oxo-3-oxazolidinyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and solubility. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as an intermediate in organic synthesis due to the presence of functional groups that can participate in various chemical reactions. The oxazolidinone ring contributes to its stability and may also impart specific biological activities. As with many organic compounds, its behavior in different solvents and under various conditions can vary significantly, making it important to consider its chemical environment when studying its properties and potential uses. Safety data and handling precautions should be reviewed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H11NO4
InChI:InChI=1S/C11H11NO4/c13-10(14)7-8-1-3-9(4-2-8)12-5-6-16-11(12)15/h1-4H,5-7H2,(H,13,14)
InChI key:HNCWJYWZNGZHAD-UHFFFAOYSA-N
SMILES:C1COC(=O)N1C2=CC=C(C=C2)CC(=O)O
Found 4 products.