CymitQuimica logo

CAS 923281-65-6

:

5-Bromo-4-fluoro-2-methoxybenzaldehyde

Description:
5-Bromo-4-fluoro-2-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a bromine atom and a fluorine atom as substituents on the benzene ring, along with a methoxy group (-OCH3) at the 2-position. The presence of these halogen atoms can influence the compound's reactivity, polarity, and overall chemical behavior, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. The methoxy group contributes to the electron-donating properties of the molecule, which can affect its electrophilic aromatic substitution reactions. Additionally, the aldehyde functional group is known for its reactivity in condensation reactions and as a precursor in the synthesis of more complex organic molecules. The compound's unique combination of substituents may also impart specific biological activities, making it a candidate for further research in drug development. Overall, 5-Bromo-4-fluoro-2-methoxybenzaldehyde is a versatile compound with significant potential in organic synthesis and pharmaceutical applications.
Formula:C8H6BrFO2
InChI:InChI=1S/C8H6BrFO2/c1-12-8-3-7(10)6(9)2-5(8)4-11/h2-4H,1H3
InChI key:InChIKey=QZLZSRXSIXNQIV-UHFFFAOYSA-N
SMILES:C(=O)C1=C(OC)C=C(F)C(Br)=C1
Synonyms:
  • Benzaldehyde, 5-bromo-4-fluoro-2-methoxy-
  • 5-Bromo-4-fluoro-2-methoxybenzaldehyde
Found 4 products.