CymitQuimica logo

CAS 923283-58-3

:

1H-Pyrazole-3-carboxylic acid, 4-amino-1-ethyl-, methyl ester

Description:
1H-Pyrazole-3-carboxylic acid, 4-amino-1-ethyl-, methyl ester, identified by its CAS number 923283-58-3, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and an ester group, indicating it can participate in various chemical reactions, such as esterification and amidation. The presence of an amino group enhances its potential for biological activity, making it of interest in pharmaceutical research. The ethyl and methyl substituents contribute to its lipophilicity, influencing its solubility and permeability properties. Typically, compounds of this nature may exhibit a range of biological activities, including antimicrobial or anti-inflammatory effects, depending on their specific structure and substituents. Additionally, the compound's stability, reactivity, and potential applications in medicinal chemistry are determined by its functional groups and overall molecular architecture. As with many organic compounds, proper handling and storage are essential to maintain its integrity and efficacy.
Formula:C7H11N3O2
InChI:InChI=1S/C7H11N3O2/c1-3-10-4-5(8)6(9-10)7(11)12-2/h4H,3,8H2,1-2H3
InChI key:InChIKey=GBUTXWFQJYQYIK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(N)=CN(CC)N1
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 4-amino-1-ethyl-, methyl ester
  • Methyl 4-amino-1-ethyl-1H-pyrazole-3-carboxylate
Found 3 products.