CymitQuimica logo

CAS 92398-50-0

:

Cycloheptanecarboxylic acid, 1-amino-, methyl ester, hydrochloride

Description:
Cycloheptanecarboxylic acid, 1-amino-, methyl ester, hydrochloride is a chemical compound characterized by its cyclic structure and functional groups. It features a cycloheptane ring, which is a seven-membered carbon ring, and contains a carboxylic acid group that is esterified with a methyl group, as well as an amino group. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. This compound is likely to exhibit properties typical of both amines and carboxylic acids, such as potential basicity due to the amino group and acidity from the carboxylic acid moiety. Its applications may span various fields, including pharmaceuticals and organic synthesis, where it could serve as an intermediate or a building block for more complex molecules. The presence of both hydrophilic and hydrophobic regions in its structure may influence its behavior in biological systems and its interaction with other chemical entities.
Formula:C9H17NO2・ClH
InChI:InChI=1S/C9H17NO2.ClH/c1-12-8(11)9(10)6-4-2-3-5-7-9;/h2-7,10H2,1H3;1H
InChI key:DUVCCEMTDGDVRL-UHFFFAOYSA-N
SMILES:COC(=O)C1(CCCCCC1)N.Cl
Found 5 products.