CymitQuimica logo

CAS 924129-01-1

:

Acetamide, N-[4-(2-benzofuranyl)-2-thiazolyl]-2-chloro-

Description:
Acetamide, N-[4-(2-benzofuranyl)-2-thiazolyl]-2-chloro- is a chemical compound characterized by its unique structural features, which include an acetamide functional group, a benzofuran moiety, and a thiazole ring. The presence of the chloro substituent indicates that it has halogenated characteristics, which can influence its reactivity and biological activity. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen and sulfur in its thiazole ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. The specific arrangement of atoms and functional groups can lead to interactions with biological targets, making it a subject of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are important factors to consider in both laboratory and industrial applications.
Formula:C13H9ClN2O2S
InChI:InChI=1S/C13H9ClN2O2S/c14-6-12(17)16-13-15-9(7-19-13)11-5-8-3-1-2-4-10(8)18-11/h1-5,7H,6H2,(H,15,16,17)
InChI key:MOJHHUUEBHLEKF-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=C(O2)C3=CSC(=N3)NC(=O)CCl
Synonyms:
  • N-(4-(Benzofuran-2-yl)thiazol-2-yl)-2-chloroacetamide
  • Acetamide, N-[4-(2-benzofuranyl)-2-thiazolyl]-2-chloro-
Found 4 products.