CymitQuimica logo

CAS 92422-79-2

:

2-(3-methylphenyl)-1,3-thiazole-4-carbaldehyde

Description:
2-(3-Methylphenyl)-1,3-thiazole-4-carbaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a carbaldehyde functional group, indicating the presence of an aldehyde (-CHO) moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 3-methylphenyl group enhances its aromatic character and may influence its solubility and interaction with other molecules. Typically, compounds like this can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The thiazole ring is known for its role in various biological systems and can serve as a scaffold for the design of pharmaceuticals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular structure and the presence of functional groups. Overall, 2-(3-methylphenyl)-1,3-thiazole-4-carbaldehyde is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C11H9NOS
InChI:InChI=1/C11H9NOS/c1-8-3-2-4-9(5-8)11-12-10(6-13)7-14-11/h2-7H,1H3
InChI key:FRSDKJVLVWGYEI-UHFFFAOYSA-N
SMILES:Cc1cccc(c1)c1nc(C=O)cs1
Synonyms:
  • 4-Thiazolecarboxaldehyde, 2-(3-Methylphenyl)-
  • 2-(3-Methylphenyl)-1,3-thiazole-4-carbaldehyde
Found 3 products.