CymitQuimica logo

CAS 924287-92-3

:

1H-Pyrazole, 4-bromo-3-(2-fluorophenyl)-1-methyl-

Description:
1H-Pyrazole, 4-bromo-3-(2-fluorophenyl)-1-methyl- is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and a 2-fluorophenyl group at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is likely to exhibit specific physical properties such as a defined melting point and solubility characteristics, influenced by the halogen substituents and the aromatic ring. Its molecular structure suggests potential for interactions in biological systems, making it of interest in drug development and synthesis. Additionally, the presence of the fluorine atom may enhance lipophilicity and metabolic stability. As with many pyrazole derivatives, this compound may exhibit various biological activities, including anti-inflammatory or anticancer properties, although specific biological data would need to be referenced for detailed insights. Safety and handling precautions should be observed due to the presence of halogens and the potential for biological activity.
Formula:C10H8BrFN2
InChI:InChI=1S/C10H8BrFN2/c1-14-6-8(11)10(13-14)7-4-2-3-5-9(7)12/h2-6H,1H3
InChI key:OFRASTDTRLBHQB-UHFFFAOYSA-N
SMILES:CN1C=C(C(=N1)C2=CC=CC=C2F)Br
Synonyms:
  • 1H-Pyrazole, 4-bromo-3-(2-fluorophenyl)-1-methyl-
Found 1 products.