CAS 92466-31-4

Formula: C15H22O3

InChI: InChI=1S/C15H22O3/c1-8-4-5-11(9(2)14(16)17)12-10(8)6-7-15(3)13(12)18-15/h8,10-13H,2,4-7H2,1,3H3,(H,16,17)/t8-,10+,11+,12+,13+,15-/m1/s1

InChI key: CQNNGKUJKJXDCO-IEFGFUDGSA-N

SMILES: C[C@@H]1CC[C@H]([C@@H]2[C@H]1CC[C@@]3([C@H]2O3)C)C(=C)C(=O)O

4,5-Epoxyartemisinic acid

CAS: 92466-31-4

Formula: C₁₅H₂₂O₃

Molecular weight: 250.3334

Ref: IN-DA00H0FR

4,5-Epoxyartemisinic acid

CAS: 92466-31-4

4,5-Epoxyartemisinic acid is a natural product for research related to life sciences. The catalog number is TN3014 and the CAS number is 92466-31-4.

Formula: C₁₅H₂₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 250.338

Ref: TM-TN3014

4,5-Epoxyartemisinic acid

CAS: 92466-31-4

Formula: C₁₅H₂₂O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 250.338

Ref: BP-SBP01521

4,5-Epoxyartemisinic acid

CAS: 92466-31-4

4,5-Epoxyartemisinic acid is a chemical compound that serves as a valuable intermediate in the synthesis of antimalarial drugs. It is derived from artemisinin, a natural compound extracted from the plant *Artemisia annua*, commonly known as sweet wormwood. The biosynthesis of 4,5-Epoxyartemisinic acid involves enzymatic transformations that help in modifying the natural structure of artemisinin to produce derivatives with enhanced efficacy or altered pharmacokinetic properties.

Formula: C₁₅H₂₂O₃

Purity: Min. 95%

Molecular weight: 250.33 g/mol

Ref: 3D-SDA46631