CAS 92496-65-6
:3′-Hydroxyflavanone
Description:
3′-Hydroxyflavanone, with the CAS number 92496-65-6, is a flavonoid compound characterized by its flavanone backbone, which consists of a chromone structure with a hydroxyl group at the 3′ position of the phenyl ring. This compound typically exhibits a yellow to orange color, which is common among flavonoids, and is soluble in organic solvents such as ethanol and methanol, but less soluble in water. 3′-Hydroxyflavanone is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological and nutraceutical research. Its structure allows for various interactions with biological molecules, contributing to its diverse effects. Additionally, it may play a role in plant pigmentation and UV protection. The compound can be synthesized through various chemical methods, including the modification of flavonoid precursors. Overall, 3′-Hydroxyflavanone represents a significant area of study within the field of natural products and medicinal chemistry.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c16-11-5-3-4-10(8-11)15-9-13(17)12-6-1-2-7-14(12)18-15/h1-8,15-16H,9H2
InChI key:InChIKey=JVSPTYZZNUXJHN-UHFFFAOYSA-N
SMILES:O=C1CC(OC=2C1=CC=CC2)C3=CC(O)=CC=C3
Synonyms:- Flavanone, 3′-hydroxy-
- 3′-Hydroxyflavanone
- 2-(3-Hydroxyphenyl)chroman-4-one
- 2,3-Dihydro-2-(3-hydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2,3-dihydro-2-(3-hydroxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3'-Hydroxyflavanone
CAS:Formula:C15H12O3Purity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalineMolecular weight:240.263'-Hydroxyflavanone
CAS:3'-Hydroxyflavanone is a naturally occurring flavonoid compound, which is derived from various plant sources, including citrus fruits and some leguminous plants. Its chemical structure contains a flavanone backbone with a hydroxyl group at the 3' position, contributing to its unique properties and biological activity.Formula:C15H12O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:240.25 g/mol3′-Hydroxyflavanone
CAS:3′-Hydroxyflavanone is a cyclized flavonoid with anti-tumor properties that induces apoptosis in HeLa cells.Formula:C15H12O3Color and Shape:SolidMolecular weight:240.253'-Hydroxyflavanone
CAS:3'-Hydroxyflavanone is a naturally occurring flavanone, which is a type of polyphenolic compound found in various plants and fruits. Known for its presence in citrus fruits and certain herbal sources, 3'-Hydroxyflavanone is characterized by its unique structural configuration, featuring a hydroxyl group that is crucial for its bioactivity.
Formula:C15H12O3Purity:Min. 95%Molecular weight:240.26 g/molRef: 3D-SDA49665
Discontinued product






