CAS 92496-65-6

3′-Hydroxyflavanone

Description:

3′-Hydroxyflavanone, with the CAS number 92496-65-6, is a flavonoid compound characterized by its flavanone backbone, which consists of a chromone structure with a hydroxyl group at the 3′ position of the phenyl ring. This compound typically exhibits a yellow to orange color, which is common among flavonoids, and is soluble in organic solvents such as ethanol and methanol, but less soluble in water. 3′-Hydroxyflavanone is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological and nutraceutical research. Its structure allows for various interactions with biological molecules, contributing to its diverse effects. Additionally, it may play a role in plant pigmentation and UV protection. The compound can be synthesized through various chemical methods, including the modification of flavonoid precursors. Overall, 3′-Hydroxyflavanone represents a significant area of study within the field of natural products and medicinal chemistry.

Formula: C₁₅H₁₂O₃

InChI: InChI=1S/C15H12O3/c16-11-5-3-4-10(8-11)15-9-13(17)12-6-1-2-7-14(12)18-15/h1-8,15-16H,9H2

InChI key: InChIKey=JVSPTYZZNUXJHN-UHFFFAOYSA-N

SMILES: O=C1CC(OC=2C1=CC=CC2)C3=CC(O)=CC=C3

Synonyms:

• Flavanone, 3′-hydroxy-
• 3′-Hydroxyflavanone
• 2-(3-Hydroxyphenyl)chroman-4-one
• 2,3-Dihydro-2-(3-hydroxyphenyl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 2,3-dihydro-2-(3-hydroxyphenyl)-

3'-Hydroxyflavanone

CAS: 92496-65-6

Formula: C₁₅H₁₂O₃

Purity: >98.0%(HPLC)

Color and Shape: White to Orange to Green powder to crystaline

Molecular weight: 240.26

Ref: 3B-H1025

3-Hydroxyflavanone

CAS: 92496-65-6

Formula: C₁₅H₁₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.2540

Ref: IN-DA003JKH

3'-Hydroxyflavanone

CAS: 92496-65-6

3'-Hydroxyflavanone

Purity: 98%

Molecular weight: 240.26g/mol

Ref: 54-OR1027867

3'-Hydroxyflavanone

CAS: 92496-65-6

Formula: C₁₅H₁₂O₃

Purity: 95%~99%

Molecular weight: 240.258

Ref: BP-BP4556

3'-Hydroxyflavanone

CAS: 92496-65-6

3'-Hydroxyflavanone is a naturally occurring flavonoid compound, which is derived from various plant sources, including citrus fruits and some leguminous plants. Its chemical structure contains a flavanone backbone with a hydroxyl group at the 3' position, contributing to its unique properties and biological activity.

Formula: C₁₅H₁₂O₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 240.25 g/mol

Ref: 3D-FH67365

2-(3-Hydroxyphenyl)chroman-4-one

CAS: 92496-65-6

Purity: 98%

Molecular weight: 240.2579956

Ref: 10-F728718

3'-Hydroxyflavanone

CAS: 92496-65-6

3'-Hydroxyflavanone is a naturally occurring flavanone, which is a type of polyphenolic compound found in various plants and fruits. Known for its presence in citrus fruits and certain herbal sources, 3'-Hydroxyflavanone is characterized by its unique structural configuration, featuring a hydroxyl group that is crucial for its bioactivity.

Formula: C₁₅H₁₂O₃

Purity: Min. 95%

Molecular weight: 240.26 g/mol

Ref: 3D-SDA49665

3′-Hydroxyflavanone

CAS: 92496-65-6

3′-Hydroxyflavanone is a cyclized flavonoid with anti-tumor properties that induces apoptosis in HeLa cells.

Formula: C₁₅H₁₂O₃

Color and Shape: Solid

Molecular weight: 240.25

Ref: TM-T201440