CAS 92496-65-6

3′-Hydroxyflavanone

Description:

3′-Hydroxyflavanone, with the CAS number 92496-65-6, is a flavonoid compound characterized by its flavanone backbone, which consists of a chromone structure with a hydroxyl group at the 3′ position of the phenyl ring. This compound typically exhibits a yellow to orange color, which is common among flavonoids, and is soluble in organic solvents such as ethanol and methanol, but less soluble in water. 3′-Hydroxyflavanone is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological and nutraceutical research. Its structure allows for various interactions with biological molecules, contributing to its diverse effects. Additionally, it may play a role in plant pigmentation and UV protection. The compound can be synthesized through various chemical methods, including the modification of flavonoid precursors. Overall, 3′-Hydroxyflavanone represents a significant area of study within the field of natural products and medicinal chemistry.

Formula: C₁₅H₁₂O₃

InChI: InChI=1S/C15H12O3/c16-11-5-3-4-10(8-11)15-9-13(17)12-6-1-2-7-14(12)18-15/h1-8,15-16H,9H2

InChI key: InChIKey=JVSPTYZZNUXJHN-UHFFFAOYSA-N

SMILES: O=C1CC(OC=2C1=CC=CC2)C3=CC(O)=CC=C3

Synonyms:

• Flavanone, 3′-hydroxy-
• 3′-Hydroxyflavanone
• 2-(3-Hydroxyphenyl)chroman-4-one
• 2,3-Dihydro-2-(3-hydroxyphenyl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 2,3-dihydro-2-(3-hydroxyphenyl)-

3'-Hydroxyflavanone

CAS: 92496-65-6

Formula: C₁₅H₁₂O₃

Purity: >98.0%(HPLC)

Color and Shape: White to Orange to Green powder to crystaline

Molecular weight: 240.26

Ref: 3B-H1025

3'-Hydroxyflavanone

CAS: 92496-65-6

3'-Hydroxyflavanone

Formula: C₁₅H₁₂O₃

Purity: 98%

Molecular weight: 240.26

Ref: 54-OR1027867

2-(3-Hydroxyphenyl)chroman-4-one

CAS: 92496-65-6

Formula: C₁₅H₁₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.2540

Ref: IN-DA003JKH

3'-Hydroxyflavanone

CAS: 92496-65-6

Formula: C₁₅H₁₂O₃

Purity: 95%~99%

Molecular weight: 240.258

Ref: BP-BP4556

2-(3-Hydroxyphenyl)chroman-4-one

CAS: 92496-65-6

Purity: 98%

Molecular weight: 240.2579956

Ref: 10-F728718

3'-Hydroxyflavanone

CAS: 92496-65-6

3'-Hydroxyflavanone is a naturally occurring flavanone, which is a type of polyphenolic compound found in various plants and fruits. Known for its presence in citrus fruits and certain herbal sources, 3'-Hydroxyflavanone is characterized by its unique structural configuration, featuring a hydroxyl group that is crucial for its bioactivity.

Formula: C₁₅H₁₂O₃

Purity: Min. 95%

Molecular weight: 240.26 g/mol

Ref: 3D-SDA49665

3′-Hydroxyflavanone

CAS: 92496-65-6

3′-Hydroxyflavanone is a flavonoid, structurally characterized by a flavanone skeleton and a 3′-hydroxyl group. 3′-Hydroxyflavanone inhibits the proliferation of HeLa cervical cancer cells and induces cell cycle arrest and apoptosis, accompanied by upregulation of p53 and p21 and downregulation of cyclin D1, exhibiting certain antitumor activity.

Formula: C₁₅H₁₂O₃

Purity: 99.96%

Color and Shape: Solid

Molecular weight: 240.254

Ref: TM-T201440

3'-Hydroxyflavanone

CAS: 92496-65-6

3'-Hydroxyflavanone is a naturally occurring flavonoid compound, which is derived from various plant sources, including citrus fruits and some leguminous plants. Its chemical structure contains a flavanone backbone with a hydroxyl group at the 3' position, contributing to its unique properties and biological activity.

Formula: C₁₅H₁₂O₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 240.25 g/mol

Ref: 3D-FH67365