CAS 92496-65-6: 3′-Hydroxyflavanone
Description:3′-Hydroxyflavanone, with the CAS number 92496-65-6, is a flavonoid compound characterized by its flavanone backbone, which consists of a chromone structure with a hydroxyl group at the 3′ position of the phenyl ring. This compound typically exhibits a yellow to orange color, which is common among flavonoids, and is soluble in organic solvents such as ethanol and methanol, but less soluble in water. 3′-Hydroxyflavanone is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological and nutraceutical research. Its structure allows for various interactions with biological molecules, contributing to its diverse effects. Additionally, it may play a role in plant pigmentation and UV protection. The compound can be synthesized through various chemical methods, including the modification of flavonoid precursors. Overall, 3′-Hydroxyflavanone represents a significant area of study within the field of natural products and medicinal chemistry.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c16-11-5-3-4-10(8-11)15-9-13(17)12-6-1-2-7-14(12)18-15/h1-8,15-16H,9H2
InChI key:InChIKey=JVSPTYZZNUXJHN-UHFFFAOYSA-N
SMILES:O=C1C=2C=CC=CC2OC(C=3C=CC=C(O)C3)C1
- Synonyms:
- Flavanone, 3′-hydroxy-
- 3′-Hydroxyflavanone
- 2-(3-Hydroxyphenyl)chroman-4-one
- 2,3-Dihydro-2-(3-hydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2,3-dihydro-2-(3-hydroxyphenyl)-
