CymitQuimica logo

CAS 92513-40-1

:

6-Chloro-2-methyl-3-quinolinecarboxylic acid

Description:
6-Chloro-2-methyl-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chloro group at the 6-position and a methyl group at the 2-position contributes to its unique reactivity and properties. This compound typically exhibits acidic behavior due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The compound may also display antimicrobial or anti-inflammatory properties, making it of interest in medicinal chemistry. Its solubility can vary depending on the solvent, and it may be sensitive to light and moisture, necessitating careful handling and storage. Overall, 6-Chloro-2-methyl-3-quinolinecarboxylic acid is a versatile compound with potential applications in drug discovery and development.
Formula:C11H8ClNO2
InChI:InChI=1S/C11H8ClNO2/c1-6-9(11(14)15)5-7-4-8(12)2-3-10(7)13-6/h2-5H,1H3,(H,14,15)
InChI key:InChIKey=BXNOWQXNZZNEJV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC2=C(N=C1C)C=CC(Cl)=C2
Synonyms:
  • 3-Quinolinecarboxylic Acid, 6-Chloro-2-Methyl-
  • 6-Chloro-2-methyl-3-quinolinecarboxylic acid
  • 6-Chloro-2-methylquinoline-3-carboxylic acid
Found 4 products.