CymitQuimica logo

CAS 925240-97-7

:

(S)-a-[Fmoc-(methyl)amino]cyclohexaneacetic acid

Description:
(S)-α-[Fmoc-(methyl)amino]cyclohexaneacetic acid is a chiral amino acid derivative characterized by its unique structure, which includes a cyclohexane ring and a fluorenylmethyloxycarbonyl (Fmoc) protecting group. The Fmoc group is commonly used in peptide synthesis to protect the amino group, allowing for selective reactions. This compound exhibits properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions due to its functional groups. The presence of the methylamino group introduces additional steric and electronic effects, influencing its reactivity and interactions in biological systems. As a chiral molecule, it can exist in two enantiomeric forms, with the (S) configuration being significant for its biological activity and potential applications in pharmaceuticals and peptide synthesis. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, this compound is valuable in the field of medicinal chemistry and peptide research.
Formula:C24H27NO4
InChI:InChI=1S/C24H27NO4/c1-25(22(23(26)27)16-9-3-2-4-10-16)24(28)29-15-21-19-13-7-5-11-17(19)18-12-6-8-14-20(18)21/h5-8,11-14,16,21-22H,2-4,9-10,15H2,1H3,(H,26,27)/t22-/m0/s1
InChI key:ZVTSJEYBSAOGMV-QFIPXVFZSA-N
SMILES:CN([C@@H](C1CCCCC1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Found 4 products.