CymitQuimica logo

CAS 92534-69-5

:

1H-Pyrazole-5-carboxylic acid, 1-methyl-4-nitro-

Description:
1H-Pyrazole-5-carboxylic acid, 1-methyl-4-nitro- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 5-position and a methyl group (-CH3) along with a nitro group (-NO2) at the 4-position of the pyrazole ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its nitro group can participate in electrophilic substitution reactions, while the carboxylic acid can engage in acid-base reactions. Overall, this compound's unique structure and functional groups make it of interest for further research and development in synthetic chemistry and medicinal applications.
Formula:C5H5N3O4
InChI:InChI=1S/C5H5N3O4/c1-7-4(5(9)10)3(2-6-7)8(11)12/h2H,1H3,(H,9,10)
InChI key:ANGMMUPJSXUXGY-UHFFFAOYSA-N
SMILES:CN1C(=C(C=N1)[N+](=O)[O-])C(=O)O
Synonyms:
  • 1-methyl-4-nitro-1H-pyrazole-5-carboxylic acid
Found 4 products.