CymitQuimica logo

CAS 92541-43-0

:

(1R,2S)-2-(methoxycarbonyl)cyclopentanecarboxylic acid

Description:
(1R,2S)-2-(methoxycarbonyl)cyclopentanecarboxylic acid, with the CAS number 92541-43-0, is a chiral compound characterized by its cyclopentane ring structure, which features a carboxylic acid and a methoxycarbonyl functional group. This compound exhibits both acidic and ester functionalities, making it relevant in organic synthesis and potential applications in pharmaceuticals. The presence of the methoxycarbonyl group contributes to its reactivity, allowing for various chemical transformations. Its stereochemistry, indicated by the (1R,2S) configuration, suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. The compound is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, while its cyclopentane framework may impart unique conformational properties. Overall, this compound's structural features and stereochemistry make it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C8H12O4
InChI:InChI=1/C8H12O4/c1-12-8(11)6-4-2-3-5(6)7(9)10/h5-6H,2-4H2,1H3,(H,9,10)/t5-,6+/m1/s1
InChI key:KYGFHAUBFNTXFK-RITPCOANSA-N
SMILES:COC(=O)[C@H]1CCC[C@H]1C(=O)O
Found 6 products.