CAS 925434-55-5

N-[2-[3-(1-Piperazinylmethyl)imidazo[2,1-B]thiazol-6-yl]phenyl]-2-quinoxalinecarboxamide

Description:

N-[2-[3-(1-Piperazinylmethyl)imidazo[2,1-B]thiazol-6-yl]phenyl]-2-quinoxalinecarboxamide is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoxaline core, an imidazothiazole moiety, and a piperazine substituent. This compound typically exhibits properties such as moderate to high solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests potential interactions with biological targets, possibly influencing pathways related to cancer or neurological disorders. The presence of the piperazine ring may enhance its pharmacokinetic properties, such as absorption and permeability. Additionally, the compound's unique arrangement of functional groups may contribute to its specificity and efficacy in biological systems. As with many compounds in drug development, further studies would be necessary to fully elucidate its mechanism of action, therapeutic potential, and safety profile.

Formula: C₂₅H₂₃N₇OS

InChI: InChI=1S/C25H23N7OS/c33-24(22-13-27-20-7-3-4-8-21(20)28-22)29-19-6-2-1-5-18(19)23-15-32-17(16-34-25(32)30-23)14-31-11-9-26-10-12-31/h1-8,13,15-16,26H,9-12,14H2,(H,29,33)

InChI key: InChIKey=IASPBORHOMBZMY-UHFFFAOYSA-N

SMILES: C(C=1N2C(=NC(=C2)C3=C(NC(=O)C4=NC5=C(N=C4)C=CC=C5)C=CC=C3)SC1)N6CCNCC6

SRT 1720

CAS: 925434-55-5

N-(2-(3-(Piperazin-1-ylmethyl)imidazo[2,1-b]thiazol-6-yl)phenyl)quinoxaline-2-carboxamide

Formula: C₂₅H₂₃N₇OS

Purity: 98%

Molecular weight: 469.56

Ref: IN-DG216992

SRT 1720

CAS: 925434-55-5

Formula: C₂₅H₂₃N₇OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 469.5614

Ref: IN-DA0064FX

SRT 1720

CAS: 925434-55-5

SRT 1720

Formula: C₂₅H₂₃N₇OS

Purity: ≥98%

Molecular weight: 469.56

Ref: 54-BUP02171

SRT 1720

CAS: 925434-55-5

SRT 1720 is a selective activator of human SIRT1 (EC1.5: 0.16 μM) and is >230-fold less potent for SIRT2 and SIRT3.

Formula: C₂₅H₂₃N₇OS

Purity: 98.84%

Color and Shape: Solid

Molecular weight: 469.56

Ref: TM-T5096

SRT 1720

CAS: 925434-55-5

SIRT1 activator

Formula: C₂₅H₂₃N₇OS

Purity: Min. 95%

Molecular weight: 469.56 g/mol

Ref: 3D-FP41292