CymitQuimica logo

CAS 925437-85-0

:

6-(2-Nitrophenyl)imidazo[2,1-b]thiazole-3-methanol

Description:
6-(2-Nitrophenyl)imidazo[2,1-b]thiazole-3-methanol is a chemical compound characterized by its complex structure, which includes an imidazole ring fused to a thiazole moiety, along with a nitrophenyl group and a hydroxymethyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the nitro and hydroxymethyl groups. The nitrophenyl group may impart specific electronic properties, influencing its reactivity and interactions in various chemical environments. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the imidazole and thiazole rings suggests potential applications in pharmaceuticals, particularly in targeting specific biological pathways. As with many organic compounds, the stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. Overall, 6-(2-Nitrophenyl)imidazo[2,1-b]thiazole-3-methanol represents a unique structure with potential applications in various fields of chemistry and biology.
Formula:C12H9N3O3S
InChI:InChI=1S/C12H9N3O3S/c16-6-8-7-19-12-13-10(5-14(8)12)9-3-1-2-4-11(9)15(17)18/h1-5,7,16H,6H2
InChI key:InChIKey=LENIQRDFJNQECM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C2=CN3C(=N2)SC=C3CO)C=CC=C1
Synonyms:
  • 3-Hydroxymethyl-6-(2-Nitrophenyl)Imidazo[2,1-B]Thiazole
  • 6-(2-Nitrophenyl)imidazo[2,1-b]thiazole-3-methanol
  • Imidazo[2,1-b]thiazole-3-methanol, 6-(2-nitrophenyl)-
  • [6-(2-Nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methanol
  • [6-(2-Nitrophenyl)imidazo[2,1-b]thiazol-3-yl]methanol
Found 3 products.