CymitQuimica logo

CAS 925441-35-6

:

2,6-Dimethyl-4-fluorobenzaldehyde

Description:
2,6-Dimethyl-4-fluorobenzaldehyde is an aromatic aldehyde characterized by its distinct functional groups and molecular structure. It features a benzene ring substituted with two methyl groups at the 2 and 6 positions, and a fluorine atom at the 4 position, along with an aldehyde (-CHO) group. This compound typically exhibits a pale yellow to light brown appearance and has a relatively low boiling point, indicative of its volatility. The presence of the fluorine atom can influence its reactivity and polarity, making it useful in various chemical syntheses and applications, particularly in the field of organic chemistry. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and as an intermediate in the synthesis of more complex organic molecules. Additionally, the compound's properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. Safety precautions should be observed when handling this substance, as with many organic compounds, due to potential toxicity and reactivity.
Formula:C9H9FO
InChI:InChI=1S/C9H9FO/c1-6-3-8(10)4-7(2)9(6)5-11/h3-5H,1-2H3
InChI key:RXQBKDVANYJVPW-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1C=O)C)F
Found 4 products.