CymitQuimica logo

CAS 925442-95-1

:

7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-one

Description:
7-Bromo-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-one is a chemical compound characterized by its unique structure, which includes a naphthalene core modified with bromine and fluorine substituents. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of bromine and fluorine atoms enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The tetrahydronaphthalene framework provides a rigid, polycyclic structure that can influence the compound's physical properties, such as solubility and melting point. Additionally, the specific arrangement of substituents can affect its biological activity, making it of interest in medicinal chemistry. Overall, 7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-one is a versatile compound with potential applications in pharmaceuticals and materials science, although its specific uses would depend on further research and development.
Formula:C10H8BrFO
InChI:InChI=1S/C10H8BrFO/c11-6-4-8-7(9(12)5-6)2-1-3-10(8)13/h4-5H,1-3H2
InChI key:ADWRVJDWLNIINO-UHFFFAOYSA-N
SMILES:C1CC2=C(C=C(C=C2F)Br)C(=O)C1
Found 4 products.