CymitQuimica logo

CAS 92546-75-3

:

Propionamide, 2-chloro-N-(p-chloro-α-methylbenzyl)-

Description:
Propionamide, 2-chloro-N-(p-chloro-α-methylbenzyl)-, identified by CAS number 92546-75-3, is an organic compound characterized by its amide functional group, which is derived from propionic acid. This compound features a chloro substituent at the 2-position of the propionamide structure and a p-chloro-α-methylbenzyl group attached to the nitrogen atom. The presence of chlorine atoms in its structure suggests potential reactivity and influences its physical properties, such as solubility and boiling point. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure indicates that it may participate in hydrogen bonding due to the amide group, affecting its interactions in biological systems. Additionally, the presence of bulky substituents can influence its steric properties, potentially impacting its reactivity and interaction with other molecules. Overall, this compound's unique structure and substituents contribute to its potential applications in various chemical and biological contexts.
Formula:C11H13Cl2NO
InChI:InChI=1S/C11H13Cl2NO/c1-7(12)11(15)14-8(2)9-3-5-10(13)6-4-9/h3-8H,1-2H3,(H,14,15)
InChI key:InChIKey=XIJGFEZWEDLLRX-UHFFFAOYSA-N
SMILES:C(NC(C(C)Cl)=O)(C)C1=CC=C(Cl)C=C1
Synonyms:
  • Propionamide, 2-chloro-N-(p-chloro-α-methylbenzyl)-
  • 2-Chloro-N-[1-(4-chlorophenyl)ethyl]propanamide
Found 1 products.