CAS 92562-77-1

Formula: C9H15N6O12P3

InChI: InChI=1S/C9H15N6O12P3/c10-7-1-2-15(9(16)12-7)8-3-5(13-14-11)6(25-8)4-24-29(20,21)27-30(22,23)26-28(17,18)19/h1-2,5-6,8H,3-4H2,(H,20,21)(H,22,23)(H2,10,12,16)(H2,17,18,19)/t5-,6+,8+/m0/s1

InChI key: KTLCZHWMPHUXRA-SHYZEUOFSA-N

SMILES: C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N=[N+]=[N-]

3′-Azido-2′,3′-dideoxy-CTP

CAS: 92562-77-1

3′-Azido-2′,3′-dideoxy-CTP (AZddCTP) is a cytidine analogue containing a 3-azido group. It functions as a chain terminator when incorporated into nascent DNA strands by HIV reverse transcriptase, effectively inhibiting DNA synthesis due to the absence of a 3'-hydroxyl group, thereby blocking viral replication. The IC50 for WTHIV is 15.6 μM, and for AZTRHIV, it is 160.8 μM. This compound exhibits antiviral activity.

Formula: C₉H₁₅N₆O₁₂P₃

Molecular weight: 492.17

Ref: TM-T211970