CymitQuimica logo

CAS 925672-85-1

:

1,6-dibromoisoquinolin-3-amine

Description:
1,6-Dibromoisoquinolin-3-amine is a chemical compound characterized by its isoquinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of two bromine atoms at the 1 and 6 positions of the isoquinoline ring significantly influences its chemical reactivity and physical properties. The amino group at the 3-position introduces basicity and potential for hydrogen bonding, making the compound of interest in various chemical reactions and applications. This compound may exhibit properties such as moderate solubility in organic solvents, and its bromine substituents can participate in electrophilic substitution reactions. Additionally, the presence of the amino group may enhance its biological activity, making it a candidate for pharmaceutical research. The compound's unique structure and functional groups suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.
Formula:C9H6Br2N2
InChI:InChI=1/C9H6Br2N2/c10-6-1-2-7-5(3-6)4-8(12)13-9(7)11/h1-4H,(H2,12,13)
InChI key:QWCRSSNILAZCCN-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Br)cc(N)nc2Br
Synonyms:
  • 3-Isoquinolinamine, 1,6-dibromo-
Found 4 products.