CymitQuimica logo

CAS 925672-86-2

:

1,7-Dibromo-3-isoquinolinamine

Description:
1,7-Dibromo-3-isoquinolinamine is a chemical compound characterized by its unique structure, which includes a dibromo substitution at the 1 and 7 positions of the isoquinoline ring system, along with an amino group at the 3 position. This compound is typically classified as a heterocyclic aromatic amine, which contributes to its potential reactivity and biological activity. The presence of bromine atoms enhances its electrophilic character, making it useful in various synthetic applications, including medicinal chemistry and material science. The amino group can participate in hydrogen bonding and may influence the compound's solubility and interaction with biological targets. Additionally, the isoquinoline framework is known for its presence in numerous natural products and pharmaceuticals, suggesting potential therapeutic applications. However, specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines. As with many brominated compounds, considerations regarding toxicity and environmental impact are essential for safe usage.
Formula:C9H6Br2N2
InChI:InChI=1S/C9H6Br2N2/c10-6-2-1-5-3-8(12)13-9(11)7(5)4-6/h1-4H,(H2,12,13)
InChI key:InChIKey=YPMHWINOTYQHHO-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=C(N)N1)C=CC(Br)=C2
Synonyms:
  • 3-Isoquinolinamine, 1,7-dibromo-
  • 3-isoquinolinamine, 1,7-dibromo-
  • 1,7-Dibromoisoquinolin-3-amine
  • 1,7-Dibromo-3-isoquinolinamine
Found 3 products.