CymitQuimica logo

CAS 925672-88-4

:

4-bromo-2-(cyanomethyl)benzonitrile

Description:
4-Bromo-2-(cyanomethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a cyano group attached to a benzene ring. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. The cyano group (-C≡N) contributes to the compound's polarity and can participate in various chemical reactions, making it a useful intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its applications may include use in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety data should be consulted, as compounds containing bromine and cyano groups can pose health hazards, including toxicity and environmental concerns. Proper handling and disposal procedures are essential when working with such substances.
Formula:C9H5BrN2
InChI:InChI=1/C9H5BrN2/c10-9-2-1-8(6-12)7(5-9)3-4-11/h1-2,5H,3H2
InChI key:ULEYEDQUDZWJBR-UHFFFAOYSA-N
SMILES:c1cc(cc(CC#N)c1C#N)Br
Synonyms:
  • Benzeneacetonitrile, 5-Bromo-2-Cyano-
  • 4-Bromo-2-(cyanomethyl)benzonitrile
Found 4 products.