CymitQuimica logo

CAS 925889-73-2

:

methyl 1-[(3-cyanophenyl)methyl]-3-formyl-indole-5-carboxylate

Description:
Methyl 1-[(3-cyanophenyl)methyl]-3-formyl-indole-5-carboxylate, with the CAS number 925889-73-2, is a synthetic organic compound characterized by its complex structure, which includes an indole core, a formyl group, and a carboxylate ester. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity and fluorescence. The presence of the cyanophenyl group may contribute to its electronic properties, potentially influencing its reactivity and interactions with biological targets. Methyl esters are generally known for their stability and solubility in organic solvents, which can facilitate various chemical reactions. The compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound represents a class of indole derivatives that could have applications in drug development or as intermediates in organic synthesis.
Formula:C19H14N2O3
InChI:InChI=1/C19H14N2O3/c1-24-19(23)15-5-6-18-17(8-15)16(12-22)11-21(18)10-14-4-2-3-13(7-14)9-20/h2-8,11-12H,10H2,1H3
InChI key:BDTZUDCWVBUYMI-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc2c(c1)c(cn2Cc1cccc(c1)C#N)C=O
Synonyms:
  • Methyl 1-(3-cyanobenzyl)-3-formyl-1H-indole-5-carboxylate
Found 2 products.