CymitQuimica logo

CAS 925889-81-2

:

tert-butyl 7-(2-methoxy-2-oxo-ethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate

Description:
Tert-butyl 7-(2-methoxy-2-oxo-ethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core, a tert-butyl ester group, and a methoxy-oxoethyl substituent. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The naphthyridine moiety may contribute to biological activity, making it of interest in medicinal chemistry. The tert-butyl group often enhances lipophilicity, which can influence the compound's pharmacokinetics. Additionally, the methoxy and keto functionalities may participate in hydrogen bonding and other intermolecular interactions, affecting the compound's stability and reactivity. Overall, this compound's unique structural features suggest potential applications in drug development or as a synthetic intermediate in organic chemistry. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C16H22N2O4
InChI:InChI=1/C16H22N2O4/c1-16(2,3)22-15(20)18-9-5-6-11-7-8-12(17-14(11)18)10-13(19)21-4/h7-8H,5-6,9-10H2,1-4H3
InChI key:IJHJVBXIXJMORX-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCc2ccc(CC(=O)OC)nc12
Found 2 products.