CymitQuimica logo

CAS 925889-93-6

:

2-Methoxy-4-(piperazin-1-yl)phenol

Description:
2-Methoxy-4-(piperazin-1-yl)phenol, identified by its CAS number 925889-93-6, is a chemical compound characterized by its phenolic structure, which includes a methoxy group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, which can influence its solubility and permeability in biological systems. The piperazine ring is known for its role in pharmacological activity, often contributing to interactions with neurotransmitter receptors. As a phenol derivative, it may also exhibit antioxidant properties. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values. Overall, 2-Methoxy-4-(piperazin-1-yl)phenol represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c1-15-11-8-9(2-3-10(11)14)13-6-4-12-5-7-13/h2-3,8,12,14H,4-7H2,1H3
InChI key:JNYQZYVLEBQJSV-UHFFFAOYSA-N
SMILES:COc1cc(ccc1O)N1CCNCC1
Synonyms:
  • 2-Methoxy-4-(1-piperazinyl)phenol
  • 2-Methoxy-4-(piperazin-1-yl)benzolol
  • Phenol, 2-methoxy-4-(1-piperazinyl)-
Found 1 products.