CymitQuimica logo

CAS 925890-84-2

:

N-(4-chloroisoquinolin-1-yl)ethane-1,2-diamine

Description:
N-(4-chloroisoquinolin-1-yl)ethane-1,2-diamine is a chemical compound characterized by its unique structure, which includes an isoquinoline moiety substituted with a chlorine atom and an ethane-1,2-diamine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of amino groups. The chlorine substituent can influence the compound's reactivity and biological activity, potentially enhancing its interaction with biological targets. As a member of the isoquinoline family, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The presence of the ethane-1,2-diamine structure suggests potential applications in drug development, particularly in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H12ClN3
InChI:InChI=1/C11H12ClN3/c12-10-7-15-11(14-6-5-13)9-4-2-1-3-8(9)10/h1-4,7H,5-6,13H2,(H,14,15)
Found 1 products.