CymitQuimica logo

CAS 925910-42-5

:

(3,4-difluoro-5-methoxyphenyl)boronic acid

Description:
(3,4-Difluoro-5-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two fluorine atoms and a methoxy group as substituents. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents. The presence of the boronic acid group allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The fluorine atoms enhance the compound's electronic properties, potentially influencing its reactivity and biological activity. The methoxy group can also affect solubility and stability. As with many boronic acids, it may exhibit sensitivity to moisture and air, necessitating careful handling and storage conditions. Overall, (3,4-difluoro-5-methoxyphenyl)boronic acid serves as a versatile building block in the development of pharmaceuticals and agrochemicals.
Formula:C7H7BF2O3
InChI:InChI=1/C7H7BF2O3/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,11-12H,1H3
InChI key:PKWMIAHGHFOLHX-UHFFFAOYSA-N
SMILES:COc1cc(cc(c1F)F)B(O)O
Found 4 products.