CAS 92592-02-4
:ethyl2-(2-benzyloxycarbonylaMinothiazol-4-yl)acetate
Description:
Ethyl 2-(2-benzyloxycarbonylamino-thiazol-4-yl)acetate is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a thiazole ring, and a benzyloxycarbonyl amino group. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the benzyloxycarbonyl group suggests that this compound may be involved in peptide synthesis or serve as a protective group in organic synthesis. Its ester functionality indicates that it can undergo hydrolysis, making it reactive in various chemical environments. The compound's molecular structure may impart specific solubility and stability characteristics, influencing its behavior in biological systems or chemical reactions. Additionally, the CAS number 92592-02-4 allows for precise identification and retrieval of information regarding this compound in chemical databases. Overall, this compound's unique features make it of interest in medicinal chemistry and synthetic organic chemistry.
Formula:C15H16N2O4S
InChI:InChI=1S/C15H16N2O4S/c1-2-20-13(18)8-12-10-22-14(16-12)17-15(19)21-9-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3,(H,16,17,19)
InChI key:PBZLVBQMTYWJAE-UHFFFAOYSA-N
SMILES:CCOC(=O)CC1=CSC(=N1)NC(=O)OCC2=CC=CC=C2
Synonyms:- Ebta
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethyl 2-(2-(((benzyloxy)carbonyl)amino)thiazol-4-yl)acetate
CAS:Formula:C15H16N2O4SMolecular weight:320.3635
