CymitQuimica logo

CAS 926-28-3

:

O,O-dimethyl S-(2-{[2-methyl-1-(methylamino)-1-oxopropan-2-yl]sulfanyl}ethyl) phosphorodithioate

Description:
O,O-Dimethyl S-(2-{[2-methyl-1-(methylamino)-1-oxopropan-2-yl]sulfanyl}ethyl) phosphorodithioate, with CAS number 926-28-3, is an organophosphorus compound that belongs to the class of phosphorodithioates. This substance is characterized by its complex molecular structure, which includes a phosphorothioate backbone and multiple functional groups, including methyl and amino moieties. It typically exhibits properties associated with organophosphates, such as potential neurotoxic effects due to its ability to inhibit acetylcholinesterase, an enzyme critical for nerve function. The compound is often used in agricultural applications as an insecticide or acaricide, reflecting its biological activity. Its solubility in organic solvents and stability under various conditions make it suitable for formulation in pesticide products. However, due to its potential toxicity, handling and usage require adherence to safety regulations and guidelines to minimize environmental and health risks. Proper storage and disposal methods are essential to mitigate any adverse effects associated with its use.
Formula:C9H20NO3PS3
InChI:InChI=1/C9H20NO3PS3/c1-9(2,8(11)10-3)16-6-7-17-14(15,12-4)13-5/h6-7H2,1-5H3,(H,10,11)
InChI key:HOZLUVSXSVHWBE-UHFFFAOYSA-N
SMILES:CC(C)(C(=O)NC)SCCSP(=S)(OC)OC
Found 1 products.