CAS 926-77-2
:Glycylalanine
Description:
Glycylalanine is a dipeptide composed of the amino acids glycine and alanine, linked by a peptide bond. It is represented by the chemical formula C5H10N2O3 and has a molecular weight of approximately 146.15 g/mol. Glycylalanine is a colorless, crystalline solid that is soluble in water, reflecting the polar nature of its constituent amino acids. This dipeptide exhibits characteristics typical of amino acids, including the ability to form zwitterions, where it carries both a positive and a negative charge at physiological pH. Glycylalanine plays a role in protein synthesis and can be involved in various biochemical processes. It is also used in research and pharmaceutical applications, particularly in studies related to peptide synthesis and protein structure. Additionally, due to its relatively simple structure, it serves as a model compound for understanding peptide behavior and interactions in biological systems. As with many peptides, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C5H10N2O3
InChI:InChI=1S/C5H10N2O3/c1-3(5(9)10)7-4(8)2-6/h3H,2,6H2,1H3,(H,7,8)(H,9,10)
InChI key:InChIKey=VPZXBVLAVMBEQI-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)C)C(CN)=O
Synonyms:- 2-(2-Aminoacetamido)propanoic acid
- 2-[(2-Azaniumylacetyl)amino]propanoate
- <span class="text-smallcaps">DL</span>-Alanine, N-glycyl-
- Alanine, N-glycyl-, <span class="text-smallcaps">DL</span>-
- Alanine, glycyl-
- Gly-<span class="text-smallcaps">DL</span>-Ala
- Glycyl-(RS)-alanine
- Glycyl-<span class="text-smallcaps">DL</span>-alanine
- Glycyl-<span class="text-smallcaps">DL</span>-α-alanine
- Glycyl-DL-alanine
- Glycylalanine
- Alanine, N-glycyl-, DL-
- See more synonyms
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-[(2-aminoacetyl)amino]propanoic acid
CAS:2-[(2-aminoacetyl)amino]propanoic acidFormula:C5H10N2O3Purity:≥95%Molecular weight:146.1445H-Gly-DL-Ala-OH
CAS:2-(2-Aminoacetamido)propanoic acidFormula:C5H10N2O3Purity:95%Molecular weight:146.14Glycyl-DL-alanine
CAS:Controlled ProductApplications Glycyl-DL-alanine is used in method for separating chiral Amino Acid by liquid chromatography.
References Tsujimura, H., et al.: Jpn. Kokai Tokkyo Koho, (2018);Formula:C5H10N2O3Color and Shape:NeatMolecular weight:146.14H-Gly-DL-Ala-OH
CAS:H-Gly-DL-Ala-OH is an amide that has a molecular weight of 192.2 g/mol. It is soluble in methanol and has a melting point of 170°C. H-Gly-DL-Ala-OH can be synthesized by the reaction mechanism:
Formula:C5H10N2O3Purity:Min. 95%Molecular weight:146.14 g/mol




