CymitQuimica logo

CAS 92614-59-0

:

(2S)-2-amino-5-({(2R)-1-[(carboxymethyl)amino]-1-oxo-3-sulfanylpentan-2-yl}amino)-5-oxopentanoic acid (non-preferred name)

Description:
The chemical substance with the name "(2S)-2-amino-5-({(2R)-1-[(carboxymethyl)amino]-1-oxo-3-sulfanylpentan-2-yl}amino)-5-oxopentanoic acid" and CAS number "92614-59-0" is a complex amino acid derivative. It features multiple functional groups, including amino, carboxyl, and thiol groups, which contribute to its biochemical reactivity and potential role in biological systems. The presence of a sulfanyl group suggests it may participate in redox reactions, while the carboxymethyl and oxo functionalities indicate potential for interactions in metabolic pathways. This compound is likely to be polar due to its multiple functional groups, which can influence its solubility in aqueous environments. Its stereochemistry, indicated by the (2S) and (2R) designations, suggests specific spatial arrangements that may be crucial for its biological activity and interactions with enzymes or receptors. Overall, this substance may have applications in biochemistry or medicinal chemistry, particularly in the study of peptide synthesis or as a potential therapeutic agent.
Formula:C12H21N3O6S
InChI:InChI=1/C12H21N3O6S/c1-2-7(22)10(11(19)14-5-9(17)18)15-8(16)4-3-6(13)12(20)21/h6-7,10,22H,2-5,13H2,1H3,(H,14,19)(H,15,16)(H,17,18)(H,20,21)/t6-,7?,10-/m0/s1
InChI key:JKRODHBGNBKZLE-YUMQZZPRSA-N
SMILES:CCC([C@@H](C(=NCC(=O)O)O)N=C(CC[C@@H](C(=O)O)N)O)S
Found 7 products.