CymitQuimica logo

CAS 926196-01-2

:

α-(Aminomethyl)-2-methyl-1H-indole-3-methanol

Description:
α-(Aminomethyl)-2-methyl-1H-indole-3-methanol, with the CAS number 926196-01-2, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features an amino group and a hydroxymethyl group, which contribute to its potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, including those involving nucleophilic substitution or hydrogen bonding. The methyl group at the 2-position of the indole ring can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. Additionally, the hydroxymethyl group at the 3-position may enhance solubility and reactivity. Such compounds are often studied for their pharmacological properties, including potential roles in medicinal chemistry and drug development. Overall, α-(Aminomethyl)-2-methyl-1H-indole-3-methanol is of interest for its structural features and possible applications in various fields, including pharmaceuticals and biochemistry.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c1-7-11(10(14)6-12)8-4-2-3-5-9(8)13-7/h2-5,10,13-14H,6,12H2,1H3
InChI key:InChIKey=HTLBSDNZNLCRSW-UHFFFAOYSA-N
SMILES:C(CN)(O)C=1C=2C(NC1C)=CC=CC2
Synonyms:
  • α-(Aminomethyl)-2-methyl-1H-indole-3-methanol
  • 1H-Indole-3-methanol, α-(aminomethyl)-2-methyl-
Found 1 products.