CymitQuimica logo

CAS 926199-99-7

:

2-Piperazinone,4-(2-aminophenyl)-

Description:
2-Piperazinone, 4-(2-aminophenyl)- is a chemical compound characterized by its piperazinone core structure, which features a piperazine ring with a carbonyl group and an amino-substituted phenyl group. This compound typically exhibits properties associated with both piperazine derivatives and aromatic amines, including potential basicity due to the presence of nitrogen atoms in the piperazine ring. It may display moderate solubility in polar solvents, influenced by the amino group, which can engage in hydrogen bonding. The presence of the phenyl group can contribute to its hydrophobic character, affecting its overall solubility and reactivity. This compound may be of interest in medicinal chemistry for its potential biological activities, as piperazine derivatives are often explored for their pharmacological properties. Additionally, its structure suggests possible interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c11-8-3-1-2-4-9(8)13-6-5-12-10(14)7-13/h1-4H,5-7,11H2,(H,12,14)
InChI key:KLAMRDOSRJKISX-UHFFFAOYSA-N
SMILES:C1CN(CC(=O)N1)C2=CC=CC=C2N
Found 2 products.