CymitQuimica logo

CAS 926212-87-5

:

N-(3-Aminophenyl)-3-furancarboxamide

Description:
N-(3-Aminophenyl)-3-furancarboxamide, with the CAS number 926212-87-5, is an organic compound characterized by its unique structural features, which include a furan ring and an amine group attached to a phenyl ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The amine group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the furan moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit moderate to high polarity, affecting its solubility in various solvents. Its synthesis often involves coupling reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. Overall, N-(3-Aminophenyl)-3-furancarboxamide is a compound of interest for further research due to its potential applications in various fields, including drug development and materials science.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c12-9-2-1-3-10(6-9)13-11(14)8-4-5-15-7-8/h1-7H,12H2,(H,13,14)
InChI key:InChIKey=PJCAHHYYWBCYGX-UHFFFAOYSA-N
SMILES:C(NC1=CC(N)=CC=C1)(=O)C=2C=COC2
Synonyms:
  • N-(3-Aminophenyl)-3-furancarboxamide
  • 3-Furancarboxamide, N-(3-aminophenyl)-
Found 1 products.