CymitQuimica logo

CAS 926221-68-3

:

3-amino-4-chloro-N-(propan-2-yl)benzamide

Description:
3-Amino-4-chloro-N-(propan-2-yl)benzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a chloro group, and an isopropyl amide side chain. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The chloro substituent introduces a halogen, which can influence the compound's reactivity and polarity. The isopropyl group contributes to the steric bulk around the amide functional group, which may affect the compound's biological activity and interactions with other molecules. This compound may exhibit properties typical of amides, such as moderate melting and boiling points, and it may be involved in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its specific applications and behavior would depend on the context of its use, such as in pharmaceuticals or agrochemicals, where its functional groups could play a critical role in its efficacy and mechanism of action.
Formula:C10H13ClN2O
InChI:InChI=1/C10H13ClN2O/c1-6(2)13-10(14)7-3-4-8(11)9(12)5-7/h3-6H,12H2,1-2H3,(H,13,14)
SMILES:CC(C)N=C(c1ccc(c(c1)N)Cl)O
Found 2 products.