CymitQuimica logo

CAS 926226-13-3

:

3-[4-[(2-Methyl-4-thiazolyl)methoxy]phenyl]-2-propenoic acid

Description:
3-[4-[(2-Methyl-4-thiazolyl)methoxy]phenyl]-2-propenoic acid, identified by its CAS number 926226-13-3, is an organic compound characterized by its unique structural features. It contains a propenoic acid moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of a thiazole ring, specifically a 2-methyl-4-thiazolyl group, enhances its biological activity and may influence its pharmacological properties. The methoxy group attached to the phenyl ring increases the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit various chemical behaviors, including acid-base properties due to the carboxylic acid functional group, and it may participate in electrophilic or nucleophilic reactions. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C14H13NO3S
InChI:InChI=1S/C14H13NO3S/c1-10-15-12(9-19-10)8-18-13-5-2-11(3-6-13)4-7-14(16)17/h2-7,9H,8H2,1H3,(H,16,17)
InChI key:InChIKey=HAXFDEBZRFATBW-UHFFFAOYSA-N
SMILES:O(CC1=CSC(C)=N1)C2=CC=C(C=CC(O)=O)C=C2
Synonyms:
  • 3-[4-[(2-Methyl-4-thiazolyl)methoxy]phenyl]-2-propenoic acid
  • 2-Propenoic acid, 3-[4-[(2-methyl-4-thiazolyl)methoxy]phenyl]-
Found 2 products.