CymitQuimica logo

CAS 926247-33-8

:

2-(4-Aminophenyl)-1-(4-morpholinyl)ethanone

Description:
2-(4-Aminophenyl)-1-(4-morpholinyl)ethanone, identified by its CAS number 926247-33-8, is an organic compound characterized by its structural features, which include an ethanone moiety linked to a 4-aminophenyl group and a morpholine ring. This compound typically exhibits properties associated with both aromatic amines and ketones, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the morpholine ring suggests that it may possess basic properties, which could influence its reactivity and interactions with biological systems. Additionally, the amino group can engage in hydrogen bonding, enhancing its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c13-11-3-1-10(2-4-11)9-12(15)14-5-7-16-8-6-14/h1-4H,5-9,13H2
InChI key:InChIKey=QNKIGGHXVDYYKX-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(N)C=C1)(=O)N2CCOCC2
Synonyms:
  • 2-(4-Aminophenyl)-1-(4-morpholinyl)ethanone
  • Ethanone, 2-(4-aminophenyl)-1-(4-morpholinyl)-
  • 2-(4-Aminophenyl)-1-morpholinoethanone
  • 2-(4-Aminophenyl)-1-(morpholin-4-yl)ethan-1-one
Found 1 products.