CymitQuimica logo

CAS 926248-27-3

:

6,7-Dihydrothieno[3,2-c]pyridine-5(4H)-acetic acid

Description:
6,7-Dihydrothieno[3,2-c]pyridine-5(4H)-acetic acid is a heterocyclic compound characterized by its unique bicyclic structure, which includes a thieno and pyridine moiety. This compound features a dihydrothieno ring fused to a pyridine ring, contributing to its distinct chemical properties. The presence of the acetic acid functional group enhances its solubility in polar solvents and may influence its biological activity. Typically, such compounds exhibit a range of pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's CAS number, 926248-27-3, serves as a unique identifier for regulatory and research purposes. Its synthesis and characterization are crucial for understanding its reactivity and potential uses in drug development or as a biochemical probe. Overall, 6,7-Dihydrothieno[3,2-c]pyridine-5(4H)-acetic acid represents a class of compounds that may offer valuable insights into the design of new pharmaceuticals.
Formula:C9H11NO2S
InChI:InChI=1S/C9H11NO2S/c11-9(12)6-10-3-1-8-7(5-10)2-4-13-8/h2,4H,1,3,5-6H2,(H,11,12)
InChI key:InChIKey=NDXRNFGHRDRBGC-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CC2=C(CC1)SC=C2
Synonyms:
  • 6,7-Dihydrothieno[3,2-c]pyridine-5(4H)-acetic acid
  • Thieno[3,2-c]pyridine-5(4H)-acetic acid, 6,7-dihydro-
Found 5 products.