CymitQuimica logo

CAS 926249-69-6

:

4-amino-3-methyl-N-(2-methylpropyl)benzamide

Description:
4-Amino-3-methyl-N-(2-methylpropyl)benzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group and a methyl group, as well as an N-(2-methylpropyl) side chain. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The methyl groups contribute to the hydrophobic character of the molecule, potentially affecting its interactions with biological systems or solvents. This compound may exhibit properties typical of amides, such as moderate polarity and the ability to form hydrogen bonds, which can impact its boiling and melting points. Additionally, the specific arrangement of substituents can influence its biological activity, making it of interest in pharmaceutical research. The CAS number 926249-69-6 uniquely identifies this compound, facilitating its recognition in chemical databases and literature. Overall, the structural features of 4-amino-3-methyl-N-(2-methylpropyl)benzamide suggest potential applications in medicinal chemistry and related fields.
Formula:C12H18N2O
InChI:InChI=1/C12H18N2O/c1-8(2)7-14-12(15)10-4-5-11(13)9(3)6-10/h4-6,8H,7,13H2,1-3H3,(H,14,15)
SMILES:CC(C)CNC(=O)c1ccc(c(C)c1)N
Synonyms:
  • 4-Amino-N-isobutyl-3-methylbenzamide
  • Benzamide, 4-amino-3-methyl-N-(2-methylpropyl)-
Found 2 products.