CymitQuimica logo

CAS 926257-07-0

:

(2-chloro-6-fluorophenyl)methanesulfonyl chloride

Description:
(2-Chloro-6-fluorophenyl)methanesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a phenyl ring substituted with both a chlorine atom and a fluorine atom, contributing to its unique electronic properties and potential biological activity. The presence of the methanesulfonyl chloride group makes it a versatile intermediate for the synthesis of various pharmaceuticals and agrochemicals, as it can participate in nucleophilic substitution reactions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is likely to be sensitive to moisture, as sulfonyl chlorides can hydrolyze to form sulfonic acids. Safety precautions are essential when handling this substance, as it may be corrosive and can cause irritation to the skin, eyes, and respiratory system. Proper storage and handling in a controlled environment are recommended to ensure safety and stability.
Formula:C7H5Cl2FO2S
InChI:InChI=1S/C7H5Cl2FO2S/c8-6-2-1-3-7(10)5(6)4-13(9,11)12/h1-3H,4H2
InChI key:VFDXEVWUTIVWCR-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)Cl)CS(=O)(=O)Cl)F
Found 1 products.