CymitQuimica logo

CAS 926307-72-4

:

1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1-oxo-, Methyl ester

Description:
1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1-oxo-, methyl ester, identified by CAS number 926307-72-4, is a chemical compound that belongs to the class of isoindoles, which are bicyclic compounds featuring a fused indole structure. This compound typically exhibits characteristics such as a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the methyl ester indicates that it can undergo hydrolysis to release methanol and form the corresponding carboxylic acid. The dihydro-1-oxo structure suggests that it may have a ketone functional group, influencing its reactivity and stability. Isoindoles are often of interest in medicinal chemistry due to their biological activity and potential applications in drug development. The compound may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many isoindole derivatives. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined through experimental methods or referenced from chemical databases for precise applications.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c1-14-10(13)6-2-3-8-7(4-6)5-11-9(8)12/h2-4H,5H2,1H3,(H,11,12)
InChI key:UPFFKPZXJRBTDT-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC2=C(C=C1)C(=O)NC2
Found 4 products.