CymitQuimica logo

CAS 92636-38-9

:

1-[4-(trifluoromethyl)phenyl]-1H-pyrrole

Description:
1-[4-(Trifluoromethyl)phenyl]-1H-pyrrole, with the CAS number 92636-38-9, is an organic compound characterized by its unique structure, which includes a pyrrole ring substituted with a para-trifluoromethylphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and reactivity influenced by the electron-withdrawing trifluoromethyl group. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry and material science. Additionally, the pyrrole moiety contributes to its potential as a ligand in coordination chemistry. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents. Its synthesis may involve methods such as electrophilic aromatic substitution or coupling reactions. Overall, 1-[4-(trifluoromethyl)phenyl]-1H-pyrrole is a valuable compound in research, particularly in the development of pharmaceuticals and advanced materials.
Formula:C11H8F3N
InChI:InChI=1/C11H8F3N/c12-11(13,14)9-3-5-10(6-4-9)15-7-1-2-8-15/h1-8H
InChI key:JFGOCJGHXODFKU-UHFFFAOYSA-N
SMILES:c1ccn(c1)c1ccc(cc1)C(F)(F)F
Found 3 products.