CymitQuimica logo

CAS 92638-85-2

:

2,7,9,9-tetramethyl-9,10-dihydroacridine

Description:
2,7,9,9-Tetramethyl-9,10-dihydroacridine is an organic compound characterized by its complex polycyclic structure, which includes an acridine core with four methyl substituents. This compound typically exhibits a pale yellow to light brown appearance and is known for its role as a fluorescent probe and in various organic synthesis applications. Its molecular structure contributes to its unique electronic properties, making it useful in photochemical studies and as a potential electron donor in various chemical reactions. The presence of multiple methyl groups enhances its solubility in organic solvents while influencing its reactivity and stability. Additionally, this compound may exhibit interesting photophysical properties, such as fluorescence, which can be utilized in analytical chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2,7,9,9-tetramethyl-9,10-dihydroacridine is a valuable compound in both research and industrial applications due to its distinctive chemical characteristics.
Formula:C17H19N
InChI:InChI=1S/C17H19N/c1-11-5-7-15-13(9-11)17(3,4)14-10-12(2)6-8-16(14)18-15/h5-10,18H,1-4H3
InChI key:IIPRZFWOSCKSIM-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1)NC3=C(C2(C)C)C=C(C=C3)C
Synonyms:
  • Acridine, 9,10-dihydro-2,7,9,9-tetramethyl-
  • 2,7,9,9-tetramethyl-9,10-dihydroacridine
  • 2,7,9,9-tetramethyl-10H-acridine
  • 3,6,9,9-tetramethyl-9,10-dihydroacridine
Found 2 products.