CymitQuimica logo

CAS 92642-09-6

:

2,2'-Bipyridine, 5,5'-bis(bromomethyl)-

Description:
2,2'-Bipyridine, 5,5'-bis(bromomethyl)- is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 2 and 2' positions. The presence of bromomethyl groups at the 5 and 5' positions enhances its reactivity, making it useful in various chemical applications, including coordination chemistry and organic synthesis. This compound typically appears as a solid and is soluble in organic solvents. Its bromomethyl substituents can participate in nucleophilic substitution reactions, allowing for further functionalization. The compound's structure contributes to its potential as a ligand in metal complexes, which can exhibit interesting electronic and catalytic properties. Additionally, due to the presence of halogen atoms, it may also exhibit unique physical properties such as increased density and altered melting points compared to its non-brominated counterparts. Safety precautions should be taken when handling this compound, as brominated organic compounds can be hazardous.
Formula:C12H10Br2N2
InChI:InChI=1S/C12H10Br2N2/c13-5-9-1-3-11(15-7-9)12-4-2-10(6-14)8-16-12/h1-4,7-8H,5-6H2
InChI key:OESAKGGTMNBXLT-UHFFFAOYSA-N
SMILES:C1=CC(=NC=C1CBr)C2=NC=C(C=C2)CBr
Found 4 products.