CymitQuimica logo

CAS 926927-42-6

:

Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate

Description:
Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a benzo[b]azepine core. This compound features an ethyl ester functional group and an amino group, contributing to its potential biological activity. The presence of the perfluoroethyl group introduces unique properties, such as increased hydrophobicity and potential interactions with biological membranes. The compound is likely to exhibit interesting pharmacological properties due to its structural features, which may influence its binding affinity to various biological targets. Additionally, the fluorinated moiety can enhance metabolic stability and alter the lipophilicity of the molecule. As with many compounds containing fluorine, it may also exhibit distinct solubility characteristics in organic solvents. Overall, Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate represents a class of compounds that could be of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C15H13F5N2O2
InChI:InChI=1S/C15H13F5N2O2/c1-2-24-13(23)9-5-8-3-4-10(14(16,17)15(18,19)20)7-11(8)22-12(21)6-9/h3-5,7H,2,6H2,1H3,(H2,21,22)
InChI key:ICZPANLPYRTVSF-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC2=C(C=C(C=C2)C(C(F)(F)F)(F)F)N=C(C1)N
Found 3 products.