CymitQuimica logo

CAS 927181-97-3

:

3-Formyl-1H-indole-6-carboxylic acid ethyl ester

Description:
3-Formyl-1H-indole-6-carboxylic acid ethyl ester is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a formyl group (-CHO) and an ethyl ester group (-COOEt) attached to the indole framework, specifically at the 3 and 6 positions, respectively. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is likely to exhibit properties typical of indole derivatives, such as fluorescence and the ability to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, its solubility in organic solvents and moderate stability under standard conditions make it suitable for various laboratory applications. As with many indole derivatives, it may also exhibit biological activity, which could be of interest in pharmaceutical research. However, specific biological properties and applications would require further investigation.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-2-16-12(15)8-3-4-10-9(7-14)6-13-11(10)5-8/h3-7,13H,2H2,1H3
InChI key:YNSYTQBKMLZEQM-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC2=C(C=C1)C(=CN2)C=O
Found 1 products.