CymitQuimica logo

CAS 92760-72-0

:

methyl (2S)-2-amino-2-methyl-butanoate hydrochloride

Description:
Methyl (2S)-2-amino-2-methyl-butanoate hydrochloride, with the CAS number 92760-72-0, is a hydrochloride salt of an amino acid derivative. This compound features a chiral center, which contributes to its specific stereochemistry, denoted by the (2S) configuration. It is characterized by the presence of an amino group (-NH2), a carboxylate group (-COO-), and a methyl group attached to a branched carbon chain, which influences its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it useful in various biochemical applications. The compound may exhibit biological activity, potentially serving as a building block in peptide synthesis or as a precursor in pharmaceutical development. Its stability, reactivity, and interaction with biological systems are influenced by its functional groups and stereochemistry, making it a subject of interest in medicinal chemistry and related fields. Proper handling and storage conditions are essential to maintain its integrity and efficacy in research or industrial applications.
Formula:C6H14ClNO2
InChI:InChI=1/C6H13NO2.ClH/c1-4-6(2,7)5(8)9-3;/h4,7H2,1-3H3;1H/t6-;/m0./s1
InChI key:HVPPPARGXDTDEY-RGMNGODLSA-N
SMILES:CC[C@@](C)(C(=O)OC)N.Cl
Synonyms:
  • L-Isovaline, methyl ester, hydrochloride (1:1)
  • Methyl L-isovalinate hydrochloride (1:1)
Found 3 products.