CymitQuimica logo

CAS 92779-72-1

:

dimethoxy[bis(4-methylphenyl)]silane

Description:
Dimethoxy[bis(4-methylphenyl)]silane, with the CAS number 92779-72-1, is an organosilicon compound characterized by its silane structure, which includes two 4-methylphenyl groups and two methoxy groups attached to a silicon atom. This compound typically appears as a colorless to pale yellow liquid and is known for its low volatility and relatively high stability under ambient conditions. It is soluble in organic solvents, making it useful in various applications, including as a coupling agent in polymer chemistry and as a precursor in the synthesis of siloxane materials. The presence of methoxy groups enhances its reactivity, allowing for hydrolysis and subsequent condensation reactions, which can lead to the formation of siloxane networks. Additionally, the aromatic 4-methylphenyl groups contribute to its thermal stability and may influence its mechanical properties when incorporated into polymer matrices. Safety precautions should be observed when handling this compound, as it may cause irritation upon contact with skin or eyes and should be used in well-ventilated areas.
Formula:C16H20O2Si
InChI:InChI=1/C16H20O2Si/c1-13-5-9-15(10-6-13)19(17-3,18-4)16-11-7-14(2)8-12-16/h5-12H,1-4H3
InChI key:SZIZIGBTHTUEBU-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)[Si](c1ccc(C)cc1)(OC)OC
Synonyms:
  • Benzene, 1,1'-(Dimethoxysilylene)Bis[4-Methyl-
Found 5 products.